Molecular Definition

Canonical SMILES OC(=O)CCCc1cn(CC(=O)O)c2c(\C=C\c3ccc(OCCCCc4ccccc4)cc3)cccc12
Formula C32H33NO5
Molecular Weight 511.61 da
Stereocenters 0/0