Molecular Definition

Canonical SMILES Nc1nc(NC(=O)c2ccccc2)ccc1c3ccccc3OC(F)(F)F
Formula C19H14F3N3O2
Molecular Weight 373.33 da
Stereocenters 0/0