Molecular Definition

Canonical SMILES COc1ccc(Cl)c(c1)c2ccc(NC(=O)C(C)C)nc2N
Formula C16H18ClN3O2
Molecular Weight 319.79 da
Stereocenters 0/0