Molecular Definition

Canonical SMILES Cn1nccc1C(=O)Nc2ccc(c(N)n2)c3ccccc3Cl
Formula C16H14ClN5O
Molecular Weight 327.77 da
Stereocenters 0/0