Molecular Definition

Canonical SMILES Cn1nccc1C(=O)Nc2ccc(c(N)n2)c3cc(Cl)ccc3Cl
Formula C16H13Cl2N5O
Molecular Weight 362.21 da
Stereocenters 0/0