Molecular Definition

Canonical SMILES CNC(=O)c1cnc(N)c(c1)c2cc(Cl)cc(Cl)c2Cl
Formula C13H10Cl3N3O
Molecular Weight 330.60 da
Stereocenters 0/0