Molecular Definition

Canonical SMILES COc1ccc(Cl)c(SC2=C(O)CC(CC2=O)c3c(Cl)ccc(NC4CCOCC4)c3Cl)c1
Formula C24H24Cl3NO4S
Molecular Weight 528.88 da
Stereocenters 0/1