Molecular Definition

Canonical SMILES CCOC(=O)Cc1ccc(Cl)c(SC2=C(O)CC(CC2=O)c3c(Cl)ccc(c3Cl)c4ccccc4)c1
Formula C28H23Cl3O4S
Molecular Weight 561.90 da
Stereocenters 0/1