Molecular Definition

Canonical SMILES CC(C)Oc1ccc(Cl)c(C2CC(=C(Sc3cc(O)ccc3C#N)C(=O)C2)O)c1Cl
Formula C22H19Cl2NO4S
Molecular Weight 464.36 da
Stereocenters 0/1