Molecular Definition

Canonical SMILES COc1ccc(Cl)c(SC2=C(O)CC(CC2=O)c3c(Cl)ccc(OC(C)C)c3Cl)c1
Formula C22H21Cl3O4S
Molecular Weight 487.82 da
Stereocenters 0/1