Molecular Definition

Canonical SMILES CC(C)Oc1ccc(Cl)c(C2CC(=C(Sc3cc(O)ccc3Cl)C(=O)C2)O)c1Cl
Formula C21H19Cl3O4S
Molecular Weight 473.80 da
Stereocenters 0/1