Target Relevance

Molecular Definition

Canonical SMILES CCN(CC)CCN(Cc1ccc(Cl)cc1)c2ccc3C=C(C(=N)N)C(=O)Oc3c2
Formula C23H27ClN4O2
Molecular Weight 426.94 da
Stereocenters 0/0