Molecular Definition

Canonical SMILES N[C@@H](COc1ccc(Cl)cc1)c2ccccc2
Formula C14H14ClNO
Molecular Weight 247.72 da
Stereocenters 1/1