Molecular Definition

Canonical SMILES C[C@H](NC(=O)[C@H](Cc1ccccc1)NC(=O)c2ccc(Br)cc2)C(=O)N[C@@H](C3CCCC3)C(=O)N[C@@H](CCCC[N+](C)(C)C)C(=O)NCCN
Formula C37H55BrN7O5
Molecular Weight 757.78 da
Stereocenters 4/5