Molecular Definition

Canonical SMILES CCC(C1=C(CCN(C)C)Cc2ccccc12)c3ccccn3
Formula C21H26N2
Molecular Weight 306.44 da
Stereocenters 0/1