Target Relevance

Molecular Definition

Canonical SMILES COc1ccc(cc1)S(=O)(=O)Nc2ccc(\C=C\C(=O)Nc3ccccc3N)cc2
Formula C22H21N3O4S
Molecular Weight 423.49 da
Stereocenters 0/0