Target Relevance

Molecular Definition

Canonical SMILES CC(C)(C)c1ccc(cc1)S(=O)(=O)Nc2ccc(\C=C\C(=O)Nc3ccccc3N)cc2
Formula C25H27N3O3S
Molecular Weight 449.57 da
Stereocenters 0/0