Target Relevance

Molecular Definition

Canonical SMILES CN(Cc1ccccc1)C(=O)c2cc3ccccc3cc2C(=O)C(c4cccc5ccccc45)P(=O)(O)O
Formula C31H26NO5P
Molecular Weight 523.52 da
Stereocenters 0/1