Molecular Definition

Canonical SMILES NC(=N)NCCCC(NC(=O)CN1CCN(CC1=O)S(=O)(=O)c2ccc3c(Cl)cccc3c2)C(=O)c4nccs4
Formula C25H28ClN7O5S2
Molecular Weight 606.12 da
Stereocenters 0/1