Molecular Definition

Canonical SMILES CCc1c(C(=O)C(=O)N)c2c(OCC(=O)O)cccc2n1Cc3cccc(Cl)c3
Formula C21H19ClN2O5
Molecular Weight 414.84 da
Stereocenters 0/0