Molecular Definition

Canonical SMILES N(c1ccc(cc1)n2ccnc2)c3ncnc4ccc(cc34)c5cncs5
Formula C20H14N6S
Molecular Weight 370.43 da
Stereocenters 0/0