Molecular Definition

Canonical SMILES N(c1ccc(cc1)c2ocnc2)c3ncnc4ccc(cc34)c5cncs5
Formula C20H13N5OS
Molecular Weight 371.42 da
Stereocenters 0/0