Molecular Definition

Canonical SMILES CS(=O)(=O)Nc1ccc(Nc2ncnc3ccc(cc23)c4cncs4)cc1
Formula C18H15N5O2S2
Molecular Weight 397.47 da
Stereocenters 0/0