Molecular Definition

Canonical SMILES CC(C)Cn1nc(C#N)c2cc(Oc3ccc(NC(=O)[C@@H]4CCCN4)cc3)ccc12
Formula C23H25N5O2
Molecular Weight 403.48 da
Stereocenters 1/1