Molecular Definition

Canonical SMILES Br.NCCCN1C(=O)c2cc(ccc2C3=C1c4cc(O)ccc4C3=O)[N+](=O)[O-]
Formula C19H16BrN3O5
Molecular Weight 446.25 da
Stereocenters 0/0