Molecular Definition

Canonical SMILES CCNc1ncc(cn1)c2ccc(cc2)C(C)(C3CC3)c4noc(n4)c5cnn(CC(=O)N(C)C)c5
Formula C26H30N8O2
Molecular Weight 486.57 da
Stereocenters 0/1