Target Relevance

Molecular Definition

Canonical SMILES CCOc1ccccc1N\N=C/2\C(=NN(C2=O)c3cc(O)cc(c3)c4ccc(cc4)N(C)C)C
Formula C26H27N5O3
Molecular Weight 457.52 da
Stereocenters 0/0