Target Relevance

Molecular Definition

Canonical SMILES FC(F)(F)c1cc(ccc1Cl)C(=O)N2CCC(CC2)N3C(Cc4ccc(OS(=O)(=O)c5cccc6cnccc56)cc4)C(=O)NC3=O
Formula C32H26ClF3N4O6S
Molecular Weight 687.09 da
Stereocenters 0/1