Target Relevance

Molecular Definition

Canonical SMILES O=C(N1CCC(CCN2C(Cc3ccc(OS(=O)(=O)c4cccc5cnccc45)cc3)C(=O)NC2=O)CC1)c6ccccc6
Formula C33H32N4O6S
Molecular Weight 612.70 da
Stereocenters 0/1