Target Relevance

Molecular Definition

Canonical SMILES O=C1NC(=O)N(CCC2CCN(Cc3ccccc3)CC2)C1Cc4ccc(OS(=O)(=O)c5cccc6cnccc56)cc4
Formula C33H34N4O5S
Molecular Weight 598.71 da
Stereocenters 0/1