Molecular Definition

Canonical SMILES Cc1cn(Cn2cnc(c3cnn(C)c3)c2c4ccc(cc4F)C#N)nn1
Formula C18H15FN8
Molecular Weight 362.36 da
Stereocenters 0/0