Target Relevance

Molecular Definition

Canonical SMILES CC(C)(C)C(=O)N1CCC(CC1)N2C(Cc3ccc(OS(=O)(=O)c4cccc5cnccc45)cc3)C(=O)NC2=O
Formula C29H32N4O6S
Molecular Weight 564.65 da
Stereocenters 0/1