Molecular Definition

Canonical SMILES Cc1cc(ccn1)C#Cc2cn(c(C)n2)c3cccc(c3)S(=O)(=O)C
Formula C19H17N3O2S
Molecular Weight 351.42 da
Stereocenters 0/0