Molecular Definition

Canonical SMILES Fc1ccc(Cn2ccc3c(cccc23)N4CCN(CCCCOc5ccc6CCC(=O)Nc6c5)CC4)cc1
Formula C32H35FN4O2
Molecular Weight 526.64 da
Stereocenters 0/0