Molecular Definition

Canonical SMILES CC(C)c1ccccc1N2CCN(CCCCCCC(=O)N3CCC[C@H]3C(=O)N4CCCCC4)CC2
Formula C30H48N4O2
Molecular Weight 496.73 da
Stereocenters 1/1