Target Relevance

Molecular Definition

Canonical SMILES OC(=O)c1cc(ncn1)c2ccc(OC3CCCCC3)c(Cl)c2
Formula C17H17ClN2O3
Molecular Weight 332.78 da
Stereocenters 0/0