Target Relevance

Molecular Definition

Canonical SMILES OC(=O)c1cc(ncn1)c2ccc(OCC3CC3)c(Cl)c2
Formula C15H13ClN2O3
Molecular Weight 304.73 da
Stereocenters 0/0