Target Relevance

Molecular Definition

Canonical SMILES OC(=O)c1cc(ncn1)c2ccc(Cl)cc2
Formula C11H7ClN2O2
Molecular Weight 234.64 da
Stereocenters 0/0