Target Relevance

Molecular Definition

Canonical SMILES Clc1ccc(cc1Cl)c2cc(ncn2)c3nn[nH]n3
Formula C11H6Cl2N6
Molecular Weight 293.11 da
Stereocenters 0/0