Target Relevance

Molecular Definition

Canonical SMILES Cc1nc(cc(n1)c2ccc(Cl)c(Cl)c2)C(=O)O
Formula C12H8Cl2N2O2
Molecular Weight 283.11 da
Stereocenters 0/0