Target Relevance

Molecular Definition

Canonical SMILES OC(=O)c1cc(ccn1)c2ccc(Cl)c(Cl)c2
Formula C12H7Cl2NO2
Molecular Weight 268.10 da
Stereocenters 0/0