Molecular Definition

Canonical SMILES Cc1nc(N)c2c(cn(C)c2n1)c3ccc4N(CC(=O)c5cc(F)cc(c5)C(F)(F)F)CCc4c3
Formula C25H21F4N5O
Molecular Weight 483.46 da
Stereocenters 0/0