Molecular Definition

Canonical SMILES Cn1cc(c2ccc3N(CC(=O)c4cc(F)cc(c4)C(F)(F)F)CCc3c2)c5c(N)ncnc15
Formula C24H19F4N5O
Molecular Weight 469.43 da
Stereocenters 0/0