Molecular Definition

Canonical SMILES O=C1c2oc(nc2C(=O)c3ccccc13)c4ccccc4
Formula C17H9NO3
Molecular Weight 275.26 da
Stereocenters 0/0