Molecular Definition

Canonical SMILES O=C(N1CCC(=C2c3ccccc3C=Cc4ccccc24)CC1)n5cncn5
Formula C23H20N4O
Molecular Weight 368.43 da
Stereocenters 0/0