Molecular Definition

Canonical SMILES OC(=O)COc1cccc2C(=CCCc12)CCON=C(c3ccccc3)c4ccccc4
Formula C27H25NO4
Molecular Weight 427.49 da
Stereocenters 0/0