Target Relevance

Molecular Definition

Canonical SMILES O[C@@H](CNCCc1ccc(N\C(=N\c2cc(Cl)cc(Cl)c2)\NC#N)cc1)c3cccnc3
Formula C23H22Cl2N6O
Molecular Weight 469.37 da
Stereocenters 1/1