Target Relevance

Molecular Definition

Canonical SMILES CCc1c(Cc2cccc3ccccc23)n4cccc(OCC(=O)O)c4c1C(=O)N
Formula C24H22N2O4
Molecular Weight 402.44 da
Stereocenters 0/0