Target Relevance

Molecular Definition

Canonical SMILES ClC1=CC=C(CCCC2CCCCC2)C(=O)O1
Formula C14H19ClO2
Molecular Weight 254.75 da
Stereocenters 0/0