Target Relevance

Molecular Definition

Canonical SMILES OCCCCSc1ccc(c2nonc12)[N+](=O)[O-]
Formula C10H11N3O4S
Molecular Weight 269.28 da
Stereocenters 0/0